Products 4461-34-1

CAS 4461-34-1 is the registry number for 2-Chlorobenzoyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.

Structural formula: {0} (CAS {1})

2-chlorobenzoyl isocyanate (CAS 4461-34-1) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 2-chlorobenzoyl isocyanate. InChIKey: ZTUIVBFRTPPWEZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H4ClNO2
Molecular weight181.57 g/mol
IUPAC name2-chlorobenzoyl isocyanate
InChIKeyZTUIVBFRTPPWEZ-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)N=C=O)Cl

Computed by PubChem (NCBI)