CAS 4461-34-1 is the registry number for 2-Chlorobenzoyl isocyanate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g, 5g.
2-chlorobenzoyl isocyanate (CAS 4461-34-1) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 2-chlorobenzoyl isocyanate. InChIKey: ZTUIVBFRTPPWEZ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 2-chlorobenzoyl isocyanate |
| InChIKey | ZTUIVBFRTPPWEZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N=C=O)Cl |
Computed by PubChem (NCBI)