CAS 7477-63-6 appears in our catalog under these names: 7–Chloroisatin, 7-Chloroisatin, 97% , 7-Chloroisatin, 7-Chloroisatin, >98.0%(GC)(T), 7-Chloroisatin 96%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 25g, 1g, 5g, 0,25kg, 0,1kg, 0,5kg, 10g, 100g.
7-chloro-1H-indole-2,3-dione (CAS 7477-63-6) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 7-chloro-1H-indole-2,3-dione. InChIKey: MPLXQMMMGDYXIT-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 7-chloro-1H-indole-2,3-dione |
| InChIKey | MPLXQMMMGDYXIT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)NC(=O)C2=O |
Computed by PubChem (NCBI)