Products 1261499-34-6
CAS 1261499-34-6 appears in our catalog under these names: 2-Chloro-3-cyanobenzoic acid, 95%, 2–Chloro–3–cyanobenzoic acid, 2-Chloro-3-cyanobenzoic acid 95%, 2-Chloro-3-cyanobenzoic acid, 95%, 95%, 2-Chloro-3-cyanobenzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
2-chloro-3-cyanobenzoic acid (CAS 1261499-34-6) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 2-chloro-3-cyanobenzoic acid. InChIKey: AHYJLSYGLUYKBZ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 2-chloro-3-cyanobenzoic acid |
| InChIKey | AHYJLSYGLUYKBZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)C(=O)O)Cl)C#N |
Computed by PubChem (NCBI)