CAS 117888-79-6 appears in our catalog under these names: (R)-2-Amino-3-(4-hydroxyphenyl)propanamide hydrochloride, 98%, H–D–Tyr–NH2 Hydrochloride, H-D-Tyr-NH2·HCl, H-D-Tyr-NH2.HCl, 95%, 95%, (R)-2-Amino-3-(4-hydroxyphenyl)propanamide hydrochloride. Offered by: AmBeed, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 10mg, 2,5g, 100mg, 250mg, 5g.
(2R)-2-amino-3-(4-hydroxyphenyl)propanamide;hydrochloride (CAS 117888-79-6) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: (2R)-2-amino-3-(4-hydroxyphenyl)propanamide;hydrochloride. InChIKey: YDIMJFKFXYQUBZ-DDWIOCJRSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | (2R)-2-amino-3-(4-hydroxyphenyl)propanamide;hydrochloride |
| InChIKey | YDIMJFKFXYQUBZ-DDWIOCJRSA-N |
| SMILES | C1=CC(=CC=C1C[C@H](C(=O)N)N)O.Cl |
Computed by PubChem (NCBI)