CAS 53559-18-5 appears in our catalog under these names: H–Tyr–NH₂ · HCl, H-L-Tyr-NH2*HCl, H-Tyr-NH2 HCl, 98%, 98%. Offered by: GLPBio, Iris Biotech, Chemat. Available pack sizes: 5g, 25g, 1g.
(2S)-2-amino-3-(4-hydroxyphenyl)propanamide;hydrochloride (CAS 53559-18-5) is a chemical compound with the molecular formula C9H13ClN2O2 and a molecular weight of 216.66 g/mol. IUPAC name: (2S)-2-amino-3-(4-hydroxyphenyl)propanamide;hydrochloride. InChIKey: YDIMJFKFXYQUBZ-QRPNPIFTSA-N.
| Molecular formula | C9H13ClN2O2 |
|---|---|
| Molecular weight | 216.66 g/mol |
| IUPAC name | (2S)-2-amino-3-(4-hydroxyphenyl)propanamide;hydrochloride |
| InChIKey | YDIMJFKFXYQUBZ-QRPNPIFTSA-N |
| SMILES | C1=CC(=CC=C1C[C@@H](C(=O)N)N)O.Cl |
Computed by PubChem (NCBI)