Products 117907-43-4

CAS 117907-43-4 is the registry number for 2-((4-amino-2-nitrophenyl)amino)benzoic acid. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-(4-amino-2-nitroanilino)benzoic acid (CAS 117907-43-4) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 273.24 g/mol. IUPAC name: 2-(4-amino-2-nitroanilino)benzoic acid. InChIKey: YESOPQNVGIQNEV-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11N3O4
Molecular weight273.24 g/mol
IUPAC name2-(4-amino-2-nitroanilino)benzoic acid
InChIKeyYESOPQNVGIQNEV-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)NC2=C(C=C(C=C2)N)[N+](=O)[O-]

Computed by PubChem (NCBI)