CAS 51594-83-3 appears in our catalog under these names: 1-(3'-Pyridylmethyl)-3-(4'-nitrophenyl)urea, Mieshuan, >95% (HPLC). Offered by: Biosynth, TRC. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 2,5g, 250mg.
Pyridin-3-ylmethyl N-(4-nitrophenyl)carbamate (CAS 51594-83-3) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 273.24 g/mol. IUPAC name: pyridin-3-ylmethyl N-(4-nitrophenyl)carbamate. InChIKey: NEJBEZATSQIMQM-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O4 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | pyridin-3-ylmethyl N-(4-nitrophenyl)carbamate |
| InChIKey | NEJBEZATSQIMQM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CN=C1)COC(=O)NC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)