Products 168263-86-3

CAS 168263-86-3 appears in our catalog under these names: (4-Benzoylamino-2-oxo-2h-pyrimidin-1-yl)-acetic acid, 95%, 2-(4-Benzamido-2-oxopyrimidin-1(2H)-yl)acetic acid 95%. Offered by: Combi-blocks, Ambeed. Available pack sizes: 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-(4-benzamido-2-oxopyrimidin-1-yl)acetic acid (CAS 168263-86-3) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 273.24 g/mol. IUPAC name: 2-(4-benzamido-2-oxopyrimidin-1-yl)acetic acid. InChIKey: ZEGIDEYRSJSRFJ-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11N3O4
Molecular weight273.24 g/mol
IUPAC name2-(4-benzamido-2-oxopyrimidin-1-yl)acetic acid
InChIKeyZEGIDEYRSJSRFJ-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(=O)NC2=NC(=O)N(C=C2)CC(=O)O

Computed by PubChem (NCBI)