CAS 202271-90-7 appears in our catalog under these names: (R)-Pomalidomide, Pomalidomide Impurity 6. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-amino-2-[(3R)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione (CAS 202271-90-7) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 273.24 g/mol. IUPAC name: 4-amino-2-[(3R)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione. InChIKey: UVSMNLNDYGZFPF-MRVPVSSYSA-N.
| Molecular formula | C13H11N3O4 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | 4-amino-2-[(3R)-2,6-dioxopiperidin-3-yl]isoindole-1,3-dione |
| InChIKey | UVSMNLNDYGZFPF-MRVPVSSYSA-N |
| SMILES | C1CC(=O)NC(=O)[C@@H]1N2C(=O)C3=C(C2=O)C(=CC=C3)N |
Computed by PubChem (NCBI)