Products 864272-34-4
CAS 864272-34-4 appears in our catalog under these names: N-Methyl-4-(4-nitrophenoxy)picolinamide, 95%, Pirfenidone Impurity 3, Sorafenib Impurity 35. Offered by: Chemat Brand, Hubei YoungXin. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
N-methyl-4-(4-nitrophenoxy)pyridine-2-carboxamide (CAS 864272-34-4) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 273.24 g/mol. IUPAC name: N-methyl-4-(4-nitrophenoxy)pyridine-2-carboxamide. InChIKey: KAJHMYQEWVHEBY-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O4 |
|---|---|
| Molecular weight | 273.24 g/mol |
| IUPAC name | N-methyl-4-(4-nitrophenoxy)pyridine-2-carboxamide |
| InChIKey | KAJHMYQEWVHEBY-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)