Products 1416575-78-4
CAS 1416575-78-4 appears in our catalog under these names: Pomalidomide-d4, Pomalidomide-(d4 major), >95% (HPLC), Pomalidomide-d4, 96.38%. Offered by: Chemat Brand, TRC, MedChemExpress. Available pack sizes: on request, 0,25mg, 1mg, 2,5mg, 1 mg.
4-amino-2-(4,4,5,5-tetradeuterio-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 1416575-78-4) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 277.27 g/mol. IUPAC name: 4-amino-2-(4,4,5,5-tetradeuterio-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: UVSMNLNDYGZFPF-CQOLUAMGSA-N.
| Molecular formula | C13H11N3O4 |
|---|---|
| Molecular weight | 277.27 g/mol |
| IUPAC name | 4-amino-2-(4,4,5,5-tetradeuterio-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | UVSMNLNDYGZFPF-CQOLUAMGSA-N |
| SMILES | [2H]C1(C(C(=O)NC(=O)C1([2H])[2H])N2C(=O)C3=C(C2=O)C(=CC=C3)N)[2H] |
Computed by PubChem (NCBI)