CAS 1377838-49-7 appears in our catalog under these names: Pomalidomide-d5, Pomalidomide–d5. Offered by: Chemat Brand, GLPBio, MedChemExpress. Available pack sizes: on request, 1mg, 500μg, 500 μg.
4-amino-2-(3,4,4,5,5-pentadeuterio-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (CAS 1377838-49-7) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 278.27 g/mol. IUPAC name: 4-amino-2-(3,4,4,5,5-pentadeuterio-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione. InChIKey: UVSMNLNDYGZFPF-XHNMXOBISA-N.
| Molecular formula | C13H11N3O4 |
|---|---|
| Molecular weight | 278.27 g/mol |
| IUPAC name | 4-amino-2-(3,4,4,5,5-pentadeuterio-2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| InChIKey | UVSMNLNDYGZFPF-XHNMXOBISA-N |
| SMILES | [2H]C1(C(=O)NC(=O)C(C1([2H])[2H])([2H])N2C(=O)C3=C(C2=O)C(=CC=C3)N)[2H] |
Computed by PubChem (NCBI)