Products 384855-46-3

CAS 384855-46-3 is the registry number for 3-Nitro-4-[(3-pyridinylmethyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

3-nitro-4-(pyridin-3-ylmethylamino)benzoic acid (CAS 384855-46-3) is a chemical compound with the molecular formula C13H11N3O4 and a molecular weight of 273.24 g/mol. IUPAC name: 3-nitro-4-(pyridin-3-ylmethylamino)benzoic acid. InChIKey: XISBJMWNSNWBAT-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11N3O4
Molecular weight273.24 g/mol
IUPAC name3-nitro-4-(pyridin-3-ylmethylamino)benzoic acid
InChIKeyXISBJMWNSNWBAT-UHFFFAOYSA-N
SMILESC1=CC(=CN=C1)CNC2=C(C=C(C=C2)C(=O)O)[N+](=O)[O-]

Computed by PubChem (NCBI)