CAS 1179880-12-6 is the registry number for 6-Chloro-N-cyclopropylpyridazine-3-carboxamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6-chloro-N-cyclopropylpyridazine-3-carboxamide (CAS 1179880-12-6) is a chemical compound with the molecular formula C8H8ClN3O and a molecular weight of 197.62 g/mol. IUPAC name: 6-chloro-N-cyclopropylpyridazine-3-carboxamide. InChIKey: GLUKDYKSLKTPRV-UHFFFAOYSA-N.
| Molecular formula | C8H8ClN3O |
|---|---|
| Molecular weight | 197.62 g/mol |
| IUPAC name | 6-chloro-N-cyclopropylpyridazine-3-carboxamide |
| InChIKey | GLUKDYKSLKTPRV-UHFFFAOYSA-N |
| SMILES | C1CC1NC(=O)C2=NN=C(C=C2)Cl |
Computed by PubChem (NCBI)