CAS 1183031-46-0 appears in our catalog under these names: 4-Bromo-2-([(tert-butoxy)carbonyl]amino)benzoic acid, 95%, 4-bromo-2-{((tert-butoxy)carbonyl)amino}benzoic acid, 4-Bromo-2-((tert-butoxycarbonyl)amino)benzoic acid, 98%, 98%, 4-Bromo-2-((tert-butoxycarbonyl)amino)benzoic acid, 98%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 1183031-46-0) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: 4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: KGGVXTYYRWMJCI-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 4-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | KGGVXTYYRWMJCI-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=CC(=C1)Br)C(=O)O |
Computed by PubChem (NCBI)