CAS 306937-20-2 appears in our catalog under these names: Boc–2–amino–5–bromobenzoic acid, 5-Bromo-2-((tert-butoxycarbonyl)amino)benzoic acid 97%, 5-Bromo-2-((tert-butoxycarbonyl)amino)benzoic acid, 96%, 96%, N-Boc-5-Bromoanthranilic acid, 96%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 250mg, 25g, 5g.
5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 306937-20-2) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: XRMSYCMCKRUWJD-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 5-bromo-2-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | XRMSYCMCKRUWJD-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Br)C(=O)O |
Computed by PubChem (NCBI)