Products 1638668-11-7
CAS 1638668-11-7 is the registry number for Methyl (R)-3-(2-bromophenyl)-2-((methoxycarbonyl)amino)propanoate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (2R)-3-(2-bromophenyl)-2-(methoxycarbonylamino)propanoate (CAS 1638668-11-7) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: methyl (2R)-3-(2-bromophenyl)-2-(methoxycarbonylamino)propanoate. InChIKey: DOJHRZUSUROQCG-SNVBAGLBSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | methyl (2R)-3-(2-bromophenyl)-2-(methoxycarbonylamino)propanoate |
| InChIKey | DOJHRZUSUROQCG-SNVBAGLBSA-N |
| SMILES | COC(=O)[C@@H](CC1=CC=CC=C1Br)NC(=O)OC |
Computed by PubChem (NCBI)