Products 2442597-45-5
CAS 2442597-45-5 appears in our catalog under these names: tert–Butyl 2–(bromomethyl)–5–nitrobenzoate, tert-Butyl 2-(bromomethyl)-5-nitrobenzoate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Tert-butyl 2-(bromomethyl)-5-nitrobenzoate (CAS 2442597-45-5) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: tert-butyl 2-(bromomethyl)-5-nitrobenzoate. InChIKey: YKFOERYPFCFEPH-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | tert-butyl 2-(bromomethyl)-5-nitrobenzoate |
| InChIKey | YKFOERYPFCFEPH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C=CC(=C1)[N+](=O)[O-])CBr |
Computed by PubChem (NCBI)