Products 483304-07-0

CAS 483304-07-0 is the registry number for Mosapride Impurity 14. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Methyl 4-acetamido-5-bromo-2-ethoxybenzoate (CAS 483304-07-0) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: methyl 4-acetamido-5-bromo-2-ethoxybenzoate. InChIKey: CDCKVFKCLQJTKG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14BrNO4
Molecular weight316.15 g/mol
IUPAC namemethyl 4-acetamido-5-bromo-2-ethoxybenzoate
InChIKeyCDCKVFKCLQJTKG-UHFFFAOYSA-N
SMILESCCOC1=CC(=C(C=C1C(=O)OC)Br)NC(=O)C

Computed by PubChem (NCBI)