Products 2680899-29-8
CAS 2680899-29-8 is the registry number for tert-Butyl (7-bromobenzo[d][1,3]dioxol-5-yl)carbamate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl N-(7-bromo-1,3-benzodioxol-5-yl)carbamate (CAS 2680899-29-8) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: tert-butyl N-(7-bromo-1,3-benzodioxol-5-yl)carbamate. InChIKey: AJEWAWRZYQZVPG-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | tert-butyl N-(7-bromo-1,3-benzodioxol-5-yl)carbamate |
| InChIKey | AJEWAWRZYQZVPG-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC2=C(C(=C1)Br)OCO2 |
Computed by PubChem (NCBI)