Products 2138121-36-3
CAS 2138121-36-3 is the registry number for 2-Bromo-3-((tert-butoxycarbonyl)amino)benzoic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid (CAS 2138121-36-3) is a chemical compound with the molecular formula C12H14BrNO4 and a molecular weight of 316.15 g/mol. IUPAC name: 2-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid. InChIKey: JBNCYRMKWGDZQA-UHFFFAOYSA-N.
| Molecular formula | C12H14BrNO4 |
|---|---|
| Molecular weight | 316.15 g/mol |
| IUPAC name | 2-bromo-3-[(2-methylpropan-2-yl)oxycarbonylamino]benzoic acid |
| InChIKey | JBNCYRMKWGDZQA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=CC(=C1Br)C(=O)O |
Computed by PubChem (NCBI)