Products 1183181-06-7
CAS 1183181-06-7 appears in our catalog under these names: 2-(3,5-Dichlorophenyl)cyclopropanecarboxylic acid, 98%, 98%, 2-(3,5-Dichlorophenyl)cyclopropane-1-carboxylic acid, 98%, 2-(3,5-Dichlorophenyl)cyclopropanecarboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
2-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid (CAS 1183181-06-7) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: IXQKEOPPCOTSSC-UHFFFAOYSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | IXQKEOPPCOTSSC-UHFFFAOYSA-N |
| SMILES | C1C(C1C(=O)O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)