CAS 220353-25-3 appears in our catalog under these names: trans–2–(3,5–dichlorophenyl)cyclopropane–1–carboxylic acid, (1R,2R)-2-(3,5-Dichlorophenyl)cyclopropanecarboxylic acid, 98%, 98%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 10g, 1g, 250mg, 5g.
Trans-(1R,2R)-2-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid (CAS 220353-25-3) is a chemical compound with the molecular formula C10H8Cl2O2 and a molecular weight of 231.07 g/mol. IUPAC name: trans-(1R,2R)-2-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid. InChIKey: IXQKEOPPCOTSSC-DTWKUNHWSA-N.
| Molecular formula | C10H8Cl2O2 |
|---|---|
| Molecular weight | 231.07 g/mol |
| IUPAC name | trans-(1R,2R)-2-(3,5-dichlorophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | IXQKEOPPCOTSSC-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)