CAS 1183418-91-8 appears in our catalog under these names: 1-(2-Fluorophenyl)-2-(3-fluorophenyl)ethanone, 95%, 1-(2-Fluorophenyl)-2-(3-fluorophenyl)ethanone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
1-(2-fluorophenyl)-2-(3-fluorophenyl)ethanone (CAS 1183418-91-8) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 1-(2-fluorophenyl)-2-(3-fluorophenyl)ethanone. InChIKey: BXZGOYRLLHKLHG-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-2-(3-fluorophenyl)ethanone |
| InChIKey | BXZGOYRLLHKLHG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC2=CC(=CC=C2)F)F |
Computed by PubChem (NCBI)