CAS 56917-38-5 appears in our catalog under these names: 1-(4-(2,6-Difluorophenyl)phenyl)ethan-1-one, 95%, 1-(4-(2,6-Difluorophenyl)phenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
1-[4-(2,6-difluorophenyl)phenyl]ethanone (CAS 56917-38-5) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 1-[4-(2,6-difluorophenyl)phenyl]ethanone. InChIKey: BYYIZFOVHMWEMX-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 1-[4-(2,6-difluorophenyl)phenyl]ethanone |
| InChIKey | BYYIZFOVHMWEMX-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=C(C=C1)C2=C(C=CC=C2F)F |
Computed by PubChem (NCBI)