CAS 75524-56-0 appears in our catalog under these names: 1-((1,1'-Biphenyl)-4-yl)-2,2-difluoroethanone, 95-<97%, 1-((1,1'-Biphenyl)-4-yl)-2,2-difluoroethanone, ≥97-<99%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
2,2-difluoro-1-(4-phenylphenyl)ethanone (CAS 75524-56-0) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 2,2-difluoro-1-(4-phenylphenyl)ethanone. InChIKey: WAFIUYHDEWGCBJ-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 2,2-difluoro-1-(4-phenylphenyl)ethanone |
| InChIKey | WAFIUYHDEWGCBJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C(=O)C(F)F |
Computed by PubChem (NCBI)