CAS 370874-66-1 appears in our catalog under these names: 2–(3–Fluorophenyl)–1–(4–fluorophenyl)ethan–1–one, 2-(3-Fluorophenyl)-1-(4-fluorophenyl)ethanone, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg.
2-(3-fluorophenyl)-1-(4-fluorophenyl)ethanone (CAS 370874-66-1) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 2-(3-fluorophenyl)-1-(4-fluorophenyl)ethanone. InChIKey: IPPIIKGVHOSCAZ-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-1-(4-fluorophenyl)ethanone |
| InChIKey | IPPIIKGVHOSCAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(=O)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)