CAS 40281-51-4 appears in our catalog under these names: 1,2-Bis(3-fluorophenyl)ethan-1-one, 95%, 1,2-Bis(3-fluorophenyl)ethanone, 95+%, 3'-Fluoro-2-(3-fluorophenyl)acetophenone. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 250mg, 1g, 5g, 2,5g.
1,2-bis(3-fluorophenyl)ethanone (CAS 40281-51-4) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 1,2-bis(3-fluorophenyl)ethanone. InChIKey: IUXIYCGOSUZQPA-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 1,2-bis(3-fluorophenyl)ethanone |
| InChIKey | IUXIYCGOSUZQPA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)CC(=O)C2=CC(=CC=C2)F |
Computed by PubChem (NCBI)