CAS 705564-12-1 is the registry number for Diflunisal Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-[2-(2,4-difluorophenyl)phenyl]ethanone (CAS 705564-12-1) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 1-[2-(2,4-difluorophenyl)phenyl]ethanone. InChIKey: LAQVGNXQADWSLQ-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 1-[2-(2,4-difluorophenyl)phenyl]ethanone |
| InChIKey | LAQVGNXQADWSLQ-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC=C1C2=C(C=C(C=C2)F)F |
Computed by PubChem (NCBI)