CAS 1184754-66-2 appears in our catalog under these names: 1-(2-Fluorophenyl)-2-(4-fluorophenyl)ethanone, 1-(2-Fluorophenyl)-2-(4-fluorophenyl)ethanone, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
1-(2-fluorophenyl)-2-(4-fluorophenyl)ethanone (CAS 1184754-66-2) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 1-(2-fluorophenyl)-2-(4-fluorophenyl)ethanone. InChIKey: GRPFFDFOPCXQEY-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 1-(2-fluorophenyl)-2-(4-fluorophenyl)ethanone |
| InChIKey | GRPFFDFOPCXQEY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)CC2=CC=C(C=C2)F)F |
Computed by PubChem (NCBI)