Products 476472-53-4
CAS 476472-53-4 is the registry number for 1-(3-Fluorophenyl)-2-(4-fluorophenyl)ethanone, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-(3-fluorophenyl)-2-(4-fluorophenyl)ethanone (CAS 476472-53-4) is a chemical compound with the molecular formula C14H10F2O and a molecular weight of 232.22 g/mol. IUPAC name: 1-(3-fluorophenyl)-2-(4-fluorophenyl)ethanone. InChIKey: FQHVPUTYTIBCJC-UHFFFAOYSA-N.
| Molecular formula | C14H10F2O |
|---|---|
| Molecular weight | 232.22 g/mol |
| IUPAC name | 1-(3-fluorophenyl)-2-(4-fluorophenyl)ethanone |
| InChIKey | FQHVPUTYTIBCJC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)