CAS 1184980-60-6 appears in our catalog under these names: 2,2,2-Trifluoro-1-(4-fluorophenyl)ethanamine hydrochloride, 95%, 2,2,2-Trifluoro-1-(4-fluorophenyl)ethylaminehydrochloride, 2,2,2-Trifluoro-1-(4-fluorophenyl)ethanamine hydrochloride, 97%, 97%, 2,2,2-Trifluoro-1-(4-fluorophenyl)ethanamine hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 10g, 5g.
2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine;hydrochloride (CAS 1184980-60-6) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: 2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine;hydrochloride. InChIKey: BMJQOPDJQFLGFV-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(4-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | BMJQOPDJQFLGFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(C(F)(F)F)N)F.Cl |
Computed by PubChem (NCBI)