Products 2153472-91-2
CAS 2153472-91-2 appears in our catalog under these names: 2,2,2-Trifluoro-1-(2-fluorophenyl)ethanamine hydrochloride, 97%, 2,2,2-Trifluoro-1-(2-fluorophenyl)ethan-1-amine hydrochloride, 95%, 2，2，2–trifluoro–1–(2–fluorophenyl)ethan–1–amine hydrochloride. Offered by: AmBeed, Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride (CAS 2153472-91-2) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: 2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride. InChIKey: BOLBLATUWRKBDZ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | BOLBLATUWRKBDZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C(F)(F)F)N)F.Cl |
Computed by PubChem (NCBI)