CAS 1391527-41-5 appears in our catalog under these names: (R)-2,2,2-Trifluoro-1-(3-fluoro-phenyl)-ethylamine hydrochloride, 95%, (R)-2,2,2-Trifluoro-1-(3-fluorophenyl)ethanamine hydrochloride, 96%, (R)-2,2,2-Trifluoro-1-(3-fluorophenyl)ethanamine hydrochloride, 96%, 96%, (R)-2,2,2-TRIFLUORO-1-(3-FLUOROPHENYL)ETHAN-1-AMINE HCL, 96%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 50mg, 500mg.
(1R)-2,2,2-trifluoro-1-(3-fluorophenyl)ethanamine;hydrochloride (CAS 1391527-41-5) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-(3-fluorophenyl)ethanamine;hydrochloride. InChIKey: XNWPGRAQALZJNF-OGFXRTJISA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-(3-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | XNWPGRAQALZJNF-OGFXRTJISA-N |
| SMILES | C1=CC(=CC(=C1)F)[C@H](C(F)(F)F)N.Cl |
Computed by PubChem (NCBI)