CAS 1391504-94-1 appears in our catalog under these names: (S)–2,2,2–Trifluoro–1–(2–fluorophenyl)ethan–1–amine hydrochloride, (S)-2,2,2-Trifluoro-1-(2-fluorophenyl)ethan-1-amine hydrochloride, 95%. Offered by: GLPBio, Combi-blocks, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
(1S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride (CAS 1391504-94-1) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: (1S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride. InChIKey: BOLBLATUWRKBDZ-FJXQXJEOSA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | (1S)-2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | BOLBLATUWRKBDZ-FJXQXJEOSA-N |
| SMILES | C1=CC=C(C(=C1)[C@@H](C(F)(F)F)N)F.Cl |
Computed by PubChem (NCBI)