CAS 643088-07-7 appears in our catalog under these names: (2–Fluoro–6–(trifluoromethyl)phenyl)methanamine hydrochloride, (2-Fluoro-6-(trifluoromethyl)phenyl)methanamine hydrochloride 97%, 2-Fluoro-6-(trifluoromethyl)benzylamine HCl, 95%, 95%, (2-Fluoro-6-(trifluoromethyl)phenyl)methanamine hydrochloride, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100mg, 250mg.
[2-fluoro-6-(trifluoromethyl)phenyl]methanamine;hydrochloride (CAS 643088-07-7) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: [2-fluoro-6-(trifluoromethyl)phenyl]methanamine;hydrochloride. InChIKey: YSYBSZNUTHPMGA-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | [2-fluoro-6-(trifluoromethyl)phenyl]methanamine;hydrochloride |
| InChIKey | YSYBSZNUTHPMGA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)CN)C(F)(F)F.Cl |
Computed by PubChem (NCBI)