Products 1215205-13-2

CAS 1215205-13-2 is the registry number for N-Methyl 4-fluoro-2-(trifluoromethyl)aniline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.

Structural formula: {0} (CAS {1})

4-fluoro-N-methyl-2-(trifluoromethyl)aniline;hydrochloride (CAS 1215205-13-2) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: 4-fluoro-N-methyl-2-(trifluoromethyl)aniline;hydrochloride. InChIKey: GQOGGYBSPYBESE-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClF4N
Molecular weight229.60 g/mol
IUPAC name4-fluoro-N-methyl-2-(trifluoromethyl)aniline;hydrochloride
InChIKeyGQOGGYBSPYBESE-UHFFFAOYSA-N
SMILESCNC1=C(C=C(C=C1)F)C(F)(F)F.Cl

Computed by PubChem (NCBI)