CAS 1215205-13-2 is the registry number for N-Methyl 4-fluoro-2-(trifluoromethyl)aniline hydrochloride, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 10g, 5g.
4-fluoro-N-methyl-2-(trifluoromethyl)aniline;hydrochloride (CAS 1215205-13-2) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: 4-fluoro-N-methyl-2-(trifluoromethyl)aniline;hydrochloride. InChIKey: GQOGGYBSPYBESE-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | 4-fluoro-N-methyl-2-(trifluoromethyl)aniline;hydrochloride |
| InChIKey | GQOGGYBSPYBESE-UHFFFAOYSA-N |
| SMILES | CNC1=C(C=C(C=C1)F)C(F)(F)F.Cl |
Computed by PubChem (NCBI)