CAS 1391445-45-6 is the registry number for (R)-2,2,2-Trifluoro-1-(2-fluorophenyl)ethan-1-amine hydrochloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R)-2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride (CAS 1391445-45-6) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: (1R)-2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride. InChIKey: BOLBLATUWRKBDZ-OGFXRTJISA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | (1R)-2,2,2-trifluoro-1-(2-fluorophenyl)ethanamine;hydrochloride |
| InChIKey | BOLBLATUWRKBDZ-OGFXRTJISA-N |
| SMILES | C1=CC=C(C(=C1)[C@H](C(F)(F)F)N)F.Cl |
Computed by PubChem (NCBI)