CAS 1254038-63-5 is the registry number for 2-(3,5-Difluorophenyl)-2,2-difluoroethan-1-amine hydrochloride, 95%. Offered by: AmBeed. Available pack sizes: 1g.
2-(3,5-difluorophenyl)-2,2-difluoroethanamine;hydrochloride (CAS 1254038-63-5) is a chemical compound with the molecular formula C8H8ClF4N and a molecular weight of 229.60 g/mol. IUPAC name: 2-(3,5-difluorophenyl)-2,2-difluoroethanamine;hydrochloride. InChIKey: YXMTWPOVMFTGMO-UHFFFAOYSA-N.
| Molecular formula | C8H8ClF4N |
|---|---|
| Molecular weight | 229.60 g/mol |
| IUPAC name | 2-(3,5-difluorophenyl)-2,2-difluoroethanamine;hydrochloride |
| InChIKey | YXMTWPOVMFTGMO-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1F)F)C(CN)(F)F.Cl |
Computed by PubChem (NCBI)