Products 1185126-58-2
CAS 1185126-58-2 is the registry number for 5–Amino–3，7–dimethyl Xanthine–d6. Offered by: GLPBio. Available pack sizes: 5mg.
1-amino-3,7-bis(trideuteriomethyl)purine-2,6-dione (CAS 1185126-58-2) is a chemical compound with the molecular formula C7H9N5O2 and a molecular weight of 201.22 g/mol. IUPAC name: 1-amino-3,7-bis(trideuteriomethyl)purine-2,6-dione. InChIKey: NAVLIYUAMBPQRQ-WFGJKAKNSA-N.
| Molecular formula | C7H9N5O2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-amino-3,7-bis(trideuteriomethyl)purine-2,6-dione |
| InChIKey | NAVLIYUAMBPQRQ-WFGJKAKNSA-N |
| SMILES | [2H]C([2H])([2H])N1C=NC2=C1C(=O)N(C(=O)N2C([2H])([2H])[2H])N |
Computed by PubChem (NCBI)