Products 1186194-79-5
CAS 1186194-79-5 is the registry number for 4-Chloro-2-fluoro-1-(2,2,2-trifluoroethyl)-benzene, 98%. Offered by: Fluorochem. Available pack sizes: 250mg, 1g.
4-chloro-2-fluoro-1-(2,2,2-trifluoroethyl)benzene (CAS 1186194-79-5) is a chemical compound with the molecular formula C8H5ClF4 and a molecular weight of 212.57 g/mol. IUPAC name: 4-chloro-2-fluoro-1-(2,2,2-trifluoroethyl)benzene. InChIKey: RRVLPECOHSARMT-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF4 |
|---|---|
| Molecular weight | 212.57 g/mol |
| IUPAC name | 4-chloro-2-fluoro-1-(2,2,2-trifluoroethyl)benzene |
| InChIKey | RRVLPECOHSARMT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)F)CC(F)(F)F |
Computed by PubChem (NCBI)