CAS 118785-96-9 appears in our catalog under these names: Cis-3-aminocyclohexane-1-carboxylic acid hydrochloride, 95%, cis-3-aminocyclohexane-1-carboxylic acid hydrochloride, 98%, 98%, (1S,3R)-3-AMINOCYCLOHEXANE-1-CARBOXYLIC ACID HCL, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 250mg, 1g, 100mg, 500mg, 100g.
Cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 118785-96-9) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: BOUHXQPJYJANEO-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | BOUHXQPJYJANEO-IBTYICNHSA-N |
| SMILES | C1C[C@H](C[C@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)