CAS 2829279-57-2 appears in our catalog under these names: (1S,3R)-3-Aminocyclohexanecarboxylic acid hydrochloride 95%, (1S,3R)-3-Aminocyclohexanecarboxylic acid hydrochloride, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Cis-(1S,3R)-3-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 2829279-57-2) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-(1S,3R)-3-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: BOUHXQPJYJANEO-RIHPBJNCSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-(1S,3R)-3-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | BOUHXQPJYJANEO-RIHPBJNCSA-N |
| SMILES | C1C[C@@H](C[C@@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)