CAS 862401-49-8 appears in our catalog under these names: Trans-3-aminocyclohexanecarboxylic acid hydrochloride, 97%, trans-3-Aminocyclohexanecarboxylic Acid HCl, trans-3-Aminocyclohexanecarboxylic acid hydrochloride, 97% , Trans-3-aminocyclohexanecarboxylic acidhydrochloride, trans-3-Aminocyclohexanecarboxylic acid hydrochloride, 97%, 97%. Offered by: Combi-blocks, Chemat Brand, Thermo Scientific (Alfa Aesar), Biosynth, Chemat. Available pack sizes: 250mg, 10g, 25g, 5g, 1g, on request, 50g, 100mg.
Trans-(1R,3R)-3-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 862401-49-8) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: trans-(1R,3R)-3-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: BOUHXQPJYJANEO-KGZKBUQUSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | trans-(1R,3R)-3-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | BOUHXQPJYJANEO-KGZKBUQUSA-N |
| SMILES | C1C[C@H](C[C@@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)