CAS 2635331-87-0 appears in our catalog under these names: (1R,3S)-3-Aminocyclohexane-1-carboxylic acid hydrochloride, 97%, (1R,3S)-3-Aminocyclohexanecarboxylic acid hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g.
Cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid;hydrochloride (CAS 2635331-87-0) is a chemical compound with the molecular formula C7H14ClNO2 and a molecular weight of 179.64 g/mol. IUPAC name: cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid;hydrochloride. InChIKey: BOUHXQPJYJANEO-IBTYICNHSA-N.
| Molecular formula | C7H14ClNO2 |
|---|---|
| Molecular weight | 179.64 g/mol |
| IUPAC name | cis-(1R,3S)-3-aminocyclohexane-1-carboxylic acid;hydrochloride |
| InChIKey | BOUHXQPJYJANEO-IBTYICNHSA-N |
| SMILES | C1C[C@H](C[C@H](C1)N)C(=O)O.Cl |
Computed by PubChem (NCBI)