Products 1187932-79-1

CAS 1187932-79-1 appears in our catalog under these names: tert-Butyl 1,7-diazaspiro(4.5)decane-7-carboxylate oxalate, 95%, tert-Butyl 1,7-diazaspiro[4.5]decane-7-carboxylate oxalate, 95%, 95%, tert-Butyl 1,7-diazaspiro[4.5]decane-7-carboxylate oxalate, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.

Tert-butyl 1,9-diazaspiro[4.5]decane-9-carboxylate;oxalic acid (CAS 1187932-79-1) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: tert-butyl 1,9-diazaspiro[4.5]decane-9-carboxylate;oxalic acid. InChIKey: SMMOACXVQZSZSN-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O6
Molecular weight330.38 g/mol
IUPAC nametert-butyl 1,9-diazaspiro[4.5]decane-9-carboxylate;oxalic acid
InChIKeySMMOACXVQZSZSN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCCC2(C1)CCCN2.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)