CAS 181955-79-3 appears in our catalog under these names: 1,4–Di–Boc–piperazine–2–carboxylic acid, 1,4-DI-BOC-PIPERAZINE-2-CARBOXYLIC ACID, 1,4-Di-Boc-piperazine-2-carboxylic acid, 97%, 97%, 1-N-Boc-4-N-Boc-Piperazine-2-carboxylic acid, 95%, 1,4-Di-Boc-piperazine-2-carboxylic acid, 97%. Offered by: GLPBio, Sigma-Aldrich, Chemat, Fluorochem, Ambeed. Available pack sizes: 25g, 5g, 1G, 250mg, 10g, 100g.
1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid (CAS 181955-79-3) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: 1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid. InChIKey: IIZGWFQKLVCLLA-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O6 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | 1,4-bis[(2-methylpropan-2-yl)oxycarbonyl]piperazine-2-carboxylic acid |
| InChIKey | IIZGWFQKLVCLLA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(C1)C(=O)O)C(=O)OC(C)(C)C |
Computed by PubChem (NCBI)