Products 1523571-85-8

CAS 1523571-85-8 appears in our catalog under these names: tert-Butyl 2,8-diazaspiro[4.5]decane-8-carboxylate hemioxalate, 95%, tert-Butyl 2,8-diazaspiro[4.5]decane-8-carboxylate oxalate(2:1) 95%, tert-Butyl 2,8-diazaspiro[4.5]decane-8-carboxylate hemioxalate, 97%, 97%, tert-Butyl 2,8-diazaspiro[4.5]decane-8-carboxylate hemioxalate, 98%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg, 10g, 500mg.

Structural formula: {0} (CAS {1})

Tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid (CAS 1523571-85-8) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: tert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid. InChIKey: GTKILXYGKZLXMM-UHFFFAOYSA-N.

Identity
Molecular formulaC15H26N2O6
Molecular weight330.38 g/mol
IUPAC nametert-butyl 2,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid
InChIKeyGTKILXYGKZLXMM-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC2(CCNC2)CC1.C(=O)(C(=O)O)O

Computed by PubChem (NCBI)