CAS 156699-39-7 appears in our catalog under these names: (S)-tetrahydropyridazine-1,2,3-tricarboxylic acid 1,2-di-tert-butyl ester, 98%, 98%, (S)-tetrahydropyridazine-1,2,3-tricarboxylic acid 1,2-di-tert-butyl ester, 98%, (3S)-1,2-bis(tert-butoxycarbonyl)-1,2-diazinane-3-carboxylic acid, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 100g, 250g, 500g.
(3S)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]diazinane-3-carboxylic acid (CAS 156699-39-7) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: (3S)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]diazinane-3-carboxylic acid. InChIKey: MLXHSDCSBUGOLZ-JTQLQIEISA-N.
| Molecular formula | C15H26N2O6 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | (3S)-1,2-bis[(2-methylpropan-2-yl)oxycarbonyl]diazinane-3-carboxylic acid |
| InChIKey | MLXHSDCSBUGOLZ-JTQLQIEISA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](N1C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)