CAS 1408075-17-1 appears in our catalog under these names: 8-Boc-1,8-diazaspiro[4.5]decane hemioxalate, 95%, 8–Boc–1,8–diazaspiro(4·5)decane oxalate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 25g, 5g, 10g, 250mg, 1g.
Tert-butyl 1,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid (CAS 1408075-17-1) is a chemical compound with the molecular formula C15H26N2O6 and a molecular weight of 330.38 g/mol. IUPAC name: tert-butyl 1,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid. InChIKey: XIIUTHUPOWLMDA-UHFFFAOYSA-N.
| Molecular formula | C15H26N2O6 |
|---|---|
| Molecular weight | 330.38 g/mol |
| IUPAC name | tert-butyl 1,8-diazaspiro[4.5]decane-8-carboxylate;oxalic acid |
| InChIKey | XIIUTHUPOWLMDA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CCCN2)CC1.C(=O)(C(=O)O)O |
Computed by PubChem (NCBI)